About [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine
[(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine (PubChem CID 134340779) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine |
| PubChem CID | 134340779 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine |
| SMILES | C/C=c1/nc(CN)[nH]/c1=C/CC |
| InChI | InChI=1S/C9H15N3/c1-3-5-8-7(4-2)11-9(6-10)12-8/h4-5H,3,6,10H2,1-2H3,(H,11,12)/b7-4+,8-5+ |
| InChIKey | XSSZGSOLXZHYIZ-NSLJXJERSA-N |
| XLogP | -0.14 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine?
The IUPAC name of [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine (CID 134340779) is [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine.
What is the SMILES notation for [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine?
The canonical SMILES for [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine is C/C=c1/nc(CN)[nH]/c1=C/CC.
What is the InChIKey of [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine?
The InChIKey is XSSZGSOLXZHYIZ-NSLJXJERSA-N. The full InChI is InChI=1S/C9H15N3/c1-3-5-8-7(4-2)11-9(6-10)12-8/h4-5H,3,6,10H2,1-2H3,(H,11,12)/b7-4+,8-5+.
What are the key properties of [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine?
[(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine has a molecular weight of 165.24 g/mol, XLogP of -0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E,5E)-4-ethylidene-5-propylidene-1H-imidazol-2-yl]methanamine is sourced from PubChem (CID 134340779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).