C19H33NO — CID 134340796
(8E)-N-ethenyl-N-ethyl-9-methoxy-2,4,6-trimethylundeca-2,8,10-trien-3-amine (PubChem CID 134340796) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (8E)-N-ethenyl-N-ethyl-9-methoxy-2,4,6-trimethylundeca-2,8,10-trien-3-amine.
| Compound Name | (8E)-N-ethenyl-N-ethyl-9-methoxy-2,4,6-trimethylundeca-2,8,10-trien-3-amine |
|---|---|
| PubChem CID | 134340796 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (8E)-N-ethenyl-N-ethyl-9-methoxy-2,4,6-trimethylundeca-2,8,10-trien-3-amine |
| SMILES | C=C/C(=C\CC(C)CC(C)C(=C(C)C)N(C=C)CC)OC |
| InChI | InChI=1S/C19H33NO/c1-9-18(21-8)13-12-16(6)14-17(7)19(15(4)5)20(10-2)11-3/h9-10,13,16-17H,1-2,11-12,14H2,3-8H3/b18-13+ |
| InChIKey | SGJIJHHGYRROLH-QGOAFFKASA-N |
| XLogP | 5.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|