C26H33N5O3 — CID 134340837
N-[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]-6-methyl-5-[1-[(1-methylpyrazol-3-yl)methoxy]ethyl]indolizine-7-carboxamide (PubChem CID 134340837) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]-6-methyl-5-[1-[(1-methylpyrazol-3-yl)methoxy]ethyl]indolizine-7-carboxamide.
| Compound Name | N-[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]-6-methyl-5-[1-[(1-methylpyrazol-3-yl)methoxy]ethyl]indolizine-7-carboxamide |
|---|---|
| PubChem CID | 134340837 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | N-[(2Z,4Z)-2-formyl-3-methyl-5-(methylamino)hexa-2,4-dienyl]-6-methyl-5-[1-[(1-methylpyrazol-3-yl)methoxy]ethyl]indolizine-7-carboxamide |
| SMILES | CN/C(C)=C\C(C)=C(/C=O)CNC(=O)c1cc2cccn2c(C(C)OCc2ccn(C)n2)c1C |
| InChI | InChI=1S/C26H33N5O3/c1-17(12-18(2)27-5)21(15-32)14-28-26(33)24-13-23-8-7-10-31(23)25(19(24)3)20(4)34-16-22-9-11-30(6)29-22/h7-13,15,20,27H,14,16H2,1-6H3,(H,28,33)/b18-12-,21-17- |
| InChIKey | DOECSJNGQZSSFQ-HTAXBBIHSA-N |
| XLogP | 3.63 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|