C18H31N3 — CID 134340884
1-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]-N,N-dimethylpiperidin-4-amine (PubChem CID 134340884) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 1-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 134340884 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 1-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]-N,N-dimethylpiperidin-4-amine |
| SMILES | C=C(/C(=C(\C)CC)N1C=CCC1)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C18H31N3/c1-6-15(2)18(21-11-7-8-12-21)16(3)20-13-9-17(10-14-20)19(4)5/h7,11,17H,3,6,8-10,12-14H2,1-2,4-5H3/b18-15- |
| InChIKey | GGFUMIQRJNDHBM-SDXDJHTJSA-N |
| XLogP | 3.43 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|