About 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine
4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine (PubChem CID 134340963) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine |
| PubChem CID | 134340963 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine |
| SMILES | C=C(/C(=C(\C)CC)N1C=CCC1)N1CCOCC1 |
| InChI | InChI=1S/C15H24N2O/c1-4-13(2)15(17-7-5-6-8-17)14(3)16-9-11-18-12-10-16/h5,7H,3-4,6,8-12H2,1-2H3/b15-13- |
| InChIKey | OEAMACSDRTUBCD-SQFISAMPSA-N |
| XLogP | 2.74 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine?
The IUPAC name of 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine (CID 134340963) is 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine.
What is the SMILES notation for 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine?
The canonical SMILES for 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine is C=C(/C(=C(\C)CC)N1C=CCC1)N1CCOCC1.
What is the InChIKey of 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine?
The InChIKey is OEAMACSDRTUBCD-SQFISAMPSA-N. The full InChI is InChI=1S/C15H24N2O/c1-4-13(2)15(17-7-5-6-8-17)14(3)16-9-11-18-12-10-16/h5,7H,3-4,6,8-12H2,1-2H3/b15-13-.
What are the key properties of 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine?
4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine has a molecular weight of 248.37 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3Z)-3-(2,3-dihydropyrrol-1-yl)-4-methylhexa-1,3-dien-2-yl]morpholine is sourced from PubChem (CID 134340963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).