About (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine
(3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine (PubChem CID 134341037) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine |
| PubChem CID | 134341037 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine |
| SMILES | C=C(/C=C\C=C/SCC)CN |
| InChI | InChI=1S/C9H15NS/c1-3-11-7-5-4-6-9(2)8-10/h4-7H,2-3,8,10H2,1H3/b6-4-,7-5- |
| InChIKey | SMAIHEIVVPQLPC-PEPZGXQESA-N |
| XLogP | 2.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine?
The IUPAC name of (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine (CID 134341037) is (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine.
What is the SMILES notation for (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine?
The canonical SMILES for (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine is C=C(/C=C\C=C/SCC)CN.
What is the InChIKey of (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine?
The InChIKey is SMAIHEIVVPQLPC-PEPZGXQESA-N. The full InChI is InChI=1S/C9H15NS/c1-3-11-7-5-4-6-9(2)8-10/h4-7H,2-3,8,10H2,1H3/b6-4-,7-5-.
What are the key properties of (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine?
(3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine has a molecular weight of 169.29 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-6-ethylsulfanyl-2-methylidenehexa-3,5-dien-1-amine is sourced from PubChem (CID 134341037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).