About 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide
2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide (PubChem CID 134341040) has the molecular formula C18H14ClN3O3S
and a molecular weight of 387.85 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide.
Molecular Properties
| Compound Name | 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide |
| PubChem CID | 134341040 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide |
| SMILES | COc1cc(Oc2ccc(Cl)cc2)nc(N2Cc3ccccc3S2=O)n1 |
| InChI | InChI=1S/C18H14ClN3O3S/c1-24-16-10-17(25-14-8-6-13(19)7-9-14)21-18(20-16)22-11-12-4-2-3-5-15(12)26(22)23/h2-10H,11H2,1H3 |
| InChIKey | KQKPSXXAHKHPQA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide?
The IUPAC name of 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide (CID 134341040) is 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide.
What is the SMILES notation for 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide?
The canonical SMILES for 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide is COc1cc(Oc2ccc(Cl)cc2)nc(N2Cc3ccccc3S2=O)n1.
What is the InChIKey of 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide?
The InChIKey is KQKPSXXAHKHPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3O3S/c1-24-16-10-17(25-14-8-6-13(19)7-9-14)21-18(20-16)22-11-12-4-2-3-5-15(12)26(22)23/h2-10H,11H2,1H3.
What are the key properties of 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide?
2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide has a molecular weight of 387.85 g/mol, XLogP of 3.97, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenoxy)-6-methoxypyrimidin-2-yl]-3H-1,2-benzothiazole 1-oxide is sourced from PubChem (CID 134341040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).