About (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol
(3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol (PubChem CID 134341186) has the molecular formula C10H16OS
and a molecular weight of 184.30 g/mol. Its IUPAC name is (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol.
Molecular Properties
| Compound Name | (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol |
| PubChem CID | 134341186 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C\C(=C/C)CCCS |
| InChI | InChI=1S/C10H16OS/c1-3-10(5-4-8-12)7-6-9(2)11/h3,6-7,11-12H,2,4-5,8H2,1H3/b7-6-,10-3- |
| InChIKey | IBTRINJOXBIZOW-UZEQNSMNSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol?
The IUPAC name of (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol (CID 134341186) is (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol.
What is the SMILES notation for (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol?
The canonical SMILES for (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol is C=C(O)/C=C\C(=C/C)CCCS.
What is the InChIKey of (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol?
The InChIKey is IBTRINJOXBIZOW-UZEQNSMNSA-N. The full InChI is InChI=1S/C10H16OS/c1-3-10(5-4-8-12)7-6-9(2)11/h3,6-7,11-12H,2,4-5,8H2,1H3/b7-6-,10-3-.
What are the key properties of (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol?
(3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol has a molecular weight of 184.30 g/mol, XLogP of 3.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-5-ethylidene-8-sulfanylocta-1,3-dien-2-ol is sourced from PubChem (CID 134341186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).