C11H13ClN2O2 — CID 134341541
ethyl 4-[(E)-2-chloroprop-1-enyl]-5-ethenyl-1H-pyrazole-3-carboxylate (PubChem CID 134341541) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is ethyl 4-[(E)-2-chloroprop-1-enyl]-5-ethenyl-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 4-[(E)-2-chloroprop-1-enyl]-5-ethenyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 134341541 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | ethyl 4-[(E)-2-chloroprop-1-enyl]-5-ethenyl-1H-pyrazole-3-carboxylate |
| SMILES | C=Cc1[nH]nc(C(=O)OCC)c1/C=C(\C)Cl |
| InChI | InChI=1S/C11H13ClN2O2/c1-4-9-8(6-7(3)12)10(14-13-9)11(15)16-5-2/h4,6H,1,5H2,2-3H3,(H,13,14)/b7-6+ |
| InChIKey | PQFIRRFUNBRSFJ-VOTSOKGWSA-N |
| XLogP | 2.83 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |