C7H12N2 — CID 134341808
5-ethenyl-1,2,3,4-tetrahydropyridin-6-amine (PubChem CID 134341808) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 5-ethenyl-1,2,3,4-tetrahydropyridin-6-amine.
| Compound Name | 5-ethenyl-1,2,3,4-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 134341808 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 5-ethenyl-1,2,3,4-tetrahydropyridin-6-amine |
| SMILES | C=CC1=C(N)NCCC1 |
| InChI | InChI=1S/C7H12N2/c1-2-6-4-3-5-9-7(6)8/h2,9H,1,3-5,8H2 |
| InChIKey | MYHGEQMFBPCAIT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |