About (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole
(4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole (PubChem CID 134342605) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole.
Molecular Properties
| Compound Name | (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole |
| PubChem CID | 134342605 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole |
| SMILES | C=C/C=c1/cnn(C)/c1=C/C=C |
| InChI | InChI=1S/C10H12N2/c1-4-6-9-8-11-12(3)10(9)7-5-2/h4-8H,1-2H2,3H3/b9-6-,10-7+ |
| InChIKey | VNLMQFNHQRKRNJ-PCCLLEMOSA-N |
| XLogP | 0.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole?
The IUPAC name of (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole (CID 134342605) is (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole.
What is the SMILES notation for (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole?
The canonical SMILES for (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole is C=C/C=c1/cnn(C)/c1=C/C=C.
What is the InChIKey of (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole?
The InChIKey is VNLMQFNHQRKRNJ-PCCLLEMOSA-N. The full InChI is InChI=1S/C10H12N2/c1-4-6-9-8-11-12(3)10(9)7-5-2/h4-8H,1-2H2,3H3/b9-6-,10-7+.
What are the key properties of (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole?
(4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole has a molecular weight of 160.22 g/mol, XLogP of 0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)pyrazole is sourced from PubChem (CID 134342605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).