C11H14N2 — CID 134342687
(4E,5E)-1,3-dimethyl-4,5-bis(prop-2-enylidene)pyrazole (PubChem CID 134342687) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (4E,5E)-1,3-dimethyl-4,5-bis(prop-2-enylidene)pyrazole.
| Compound Name | (4E,5E)-1,3-dimethyl-4,5-bis(prop-2-enylidene)pyrazole |
|---|---|
| PubChem CID | 134342687 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (4E,5E)-1,3-dimethyl-4,5-bis(prop-2-enylidene)pyrazole |
| SMILES | C=C/C=c1/c(C)nn(C)/c1=C/C=C |
| InChI | InChI=1S/C11H14N2/c1-5-7-10-9(3)12-13(4)11(10)8-6-2/h5-8H,1-2H2,3-4H3/b10-7-,11-8+ |
| InChIKey | VYXRRMZXPXKSEP-BDLVGCLISA-N |
| XLogP | 0.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |