C13H16F3N — CID 134342924
N-[(E)-3-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)but-2-en-2-yl]propan-2-imine (PubChem CID 134342924) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[(E)-3-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)but-2-en-2-yl]propan-2-imine.
| Compound Name | N-[(E)-3-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)but-2-en-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 134342924 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-[(E)-3-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)but-2-en-2-yl]propan-2-imine |
| SMILES | CC(C)=N/C(C)=C(\C)C1=C(F)C=C(F)CC1F |
| InChI | InChI=1S/C13H16F3N/c1-7(2)17-9(4)8(3)13-11(15)5-10(14)6-12(13)16/h5,12H,6H2,1-4H3/b9-8+ |
| InChIKey | OCQOBQXKCQPSFX-CMDGGOBGSA-N |
| XLogP | 4.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|