About 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one
10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 134342928) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one.
Molecular Properties
| Compound Name | 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one |
| PubChem CID | 134342928 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | CCCC1C2CCC1C1OC(=O)OC21 |
| InChI | InChI=1S/C11H16O3/c1-2-3-6-7-4-5-8(6)10-9(7)13-11(12)14-10/h6-10H,2-5H2,1H3 |
| InChIKey | QLEOHRGIZOPJOT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
The IUPAC name of 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one (CID 134342928) is 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one.
What is the SMILES notation for 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
The canonical SMILES for 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one is CCCC1C2CCC1C1OC(=O)OC21.
What is the InChIKey of 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
The InChIKey is QLEOHRGIZOPJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-2-3-6-7-4-5-8(6)10-9(7)13-11(12)14-10/h6-10H,2-5H2,1H3.
What are the key properties of 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one has a molecular weight of 196.25 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-propyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one is sourced from PubChem (CID 134342928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).