About 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile
5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile (PubChem CID 134342939) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile.
Molecular Properties
| Compound Name | 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile |
| PubChem CID | 134342939 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile |
| SMILES | CC1C2CC3C1OC(O)C3C2C#N |
| InChI | InChI=1S/C10H13NO2/c1-4-5-2-6-8(7(5)3-11)10(12)13-9(4)6/h4-10,12H,2H2,1H3 |
| InChIKey | IQIFXZYYPJKHSO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile?
The IUPAC name of 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile (CID 134342939) is 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile.
What is the SMILES notation for 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile?
The canonical SMILES for 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile is CC1C2CC3C1OC(O)C3C2C#N.
What is the InChIKey of 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile?
The InChIKey is IQIFXZYYPJKHSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-4-5-2-6-8(7(5)3-11)10(12)13-9(4)6/h4-10,12H,2H2,1H3.
What are the key properties of 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile?
5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile has a molecular weight of 179.22 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-methyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile is sourced from PubChem (CID 134342939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).