C36H54F2N2 — CID 134343737
2-[4-[3-[(3E,5E,6Z)-1,1-difluoro-7,8-dimethyl-5-(2-methylprop-2-enylidene)-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-N,N-dimethylprop-2-en-1-amine (PubChem CID 134343737) has the molecular formula C36H54F2N2 and a molecular weight of 552.84 g/mol. Its IUPAC name is 2-[4-[3-[(3E,5E,6Z)-1,1-difluoro-7,8-dimethyl-5-(2-methylprop-2-enylidene)-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-N,N-dimethylprop-2-en-1-amine.
| Compound Name | 2-[4-[3-[(3E,5E,6Z)-1,1-difluoro-7,8-dimethyl-5-(2-methylprop-2-enylidene)-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 134343737 |
| Molecular Formula | C36H54F2N2 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.43 |
| IUPAC Name | 2-[4-[3-[(3E,5E,6Z)-1,1-difluoro-7,8-dimethyl-5-(2-methylprop-2-enylidene)-4-propyldeca-3,6-dien-3-yl]-4-methylphenyl]piperidin-1-yl]-N,N-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)/C=C(\C=C(\C)C(C)CC)C(/CCC)=C(\CC(F)F)c1cc(C2CCN(C(=C)CN(C)C)CC2)ccc1C |
| InChI | InChI=1S/C36H54F2N2/c1-11-13-33(32(20-25(3)4)21-28(7)26(5)12-2)35(23-36(37)38)34-22-31(15-14-27(34)6)30-16-18-40(19-17-30)29(8)24-39(9)10/h14-15,20-22,26,30,36H,3,8,11-13,16-19,23-24H2,1-2,4-7,9-10H3/b28-21-,32-20+,35-33+ |
| InChIKey | WGDTUABONYHUIF-BEQOIKQTSA-N |
| XLogP | 9.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|