About 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole
2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole (PubChem CID 134343933) has the molecular formula C24H14N2O2S
and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole |
| PubChem CID | 134343933 |
| Molecular Formula | C24H14N2O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2cccc3sc(-c4ncco4)cc23)c(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C24H14N2O2S/c1-2-7-17(23-26-19-9-3-4-10-20(19)28-23)15(6-1)16-8-5-11-21-18(16)14-22(29-21)24-25-12-13-27-24/h1-14H |
| InChIKey | JSMPLUVLWDEUIU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole?
The IUPAC name of 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole (CID 134343933) is 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole?
The canonical SMILES for 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole is c1ccc(-c2cccc3sc(-c4ncco4)cc23)c(-c2nc3ccccc3o2)c1.
What is the InChIKey of 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole?
The InChIKey is JSMPLUVLWDEUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14N2O2S/c1-2-7-17(23-26-19-9-3-4-10-20(19)28-23)15(6-1)16-8-5-11-21-18(16)14-22(29-21)24-25-12-13-27-24/h1-14H.
What are the key properties of 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole?
2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole has a molecular weight of 394.46 g/mol, XLogP of 7.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(1,3-oxazol-2-yl)-1-benzothiophen-4-yl]phenyl]-1,3-benzoxazole is sourced from PubChem (CID 134343933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).