About (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine
(2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine (PubChem CID 134344024) has the molecular formula C20H26NP
and a molecular weight of 311.41 g/mol. Its IUPAC name is (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine.
Molecular Properties
| Compound Name | (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine |
| PubChem CID | 134344024 |
| Molecular Formula | C20H26NP |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine |
| SMILES | CCCCNP1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H26NP/c1-2-3-16-21-22-19(17-10-6-4-7-11-17)14-15-20(22)18-12-8-5-9-13-18/h4-13,19-21H,2-3,14-16H2,1H3/t19-,20-/m1/s1 |
| InChIKey | RAOYAAJVQCMFAP-WOJBJXKFSA-N |
| XLogP | 6.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine?
The IUPAC name of (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine (CID 134344024) is (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine.
What is the SMILES notation for (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine?
The canonical SMILES for (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine is CCCCNP1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1.
What is the InChIKey of (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine?
The InChIKey is RAOYAAJVQCMFAP-WOJBJXKFSA-N. The full InChI is InChI=1S/C20H26NP/c1-2-3-16-21-22-19(17-10-6-4-7-11-17)14-15-20(22)18-12-8-5-9-13-18/h4-13,19-21H,2-3,14-16H2,1H3/t19-,20-/m1/s1.
What are the key properties of (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine?
(2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine has a molecular weight of 311.41 g/mol, XLogP of 6.05, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-N-butyl-2,5-diphenylphospholan-1-amine is sourced from PubChem (CID 134344024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).