C32H25F10NP2 — CID 134344248
(2S,5S)-N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine (PubChem CID 134344248) has the molecular formula C32H25F10NP2 and a molecular weight of 675.49 g/mol. Its IUPAC name is (2S,5S)-N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine.
| Compound Name | (2S,5S)-N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 134344248 |
| Molecular Formula | C32H25F10NP2 |
| Molecular Weight | 675.49 g/mol |
| Exact Mass | 675.13 |
| IUPAC Name | (2S,5S)-N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine |
| SMILES | CCCCN(P(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)P1[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H25F10NP2/c1-2-3-16-43(44-19(17-10-6-4-7-11-17)14-15-20(44)18-12-8-5-9-13-18)45(31-27(39)23(35)21(33)24(36)28(31)40)32-29(41)25(37)22(34)26(38)30(32)42/h4-13,19-20H,2-3,14-16H2,1H3/t19-,20-/m0/s1 |
| InChIKey | YQPBLHRMCIVBJV-PMACEKPBSA-N |
| XLogP | 10.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.49 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|