C32H31F4NP2 — CID 134344325
(2R,5R)-N-bis(3,5-difluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine (PubChem CID 134344325) has the molecular formula C32H31F4NP2 and a molecular weight of 567.55 g/mol. Its IUPAC name is (2R,5R)-N-bis(3,5-difluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine.
| Compound Name | (2R,5R)-N-bis(3,5-difluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 134344325 |
| Molecular Formula | C32H31F4NP2 |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | (2R,5R)-N-bis(3,5-difluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine |
| SMILES | CCCCN(P(c1cc(F)cc(F)c1)c1cc(F)cc(F)c1)P1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H31F4NP2/c1-2-3-16-37(38(29-19-25(33)17-26(34)20-29)30-21-27(35)18-28(36)22-30)39-31(23-10-6-4-7-11-23)14-15-32(39)24-12-8-5-9-13-24/h4-13,17-22,31-32H,2-3,14-16H2,1H3/t31-,32-/m1/s1 |
| InChIKey | HETFRPKISBEQKD-ROJLCIKYSA-N |
| XLogP | 9.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|