C13H16FN5O7 — CID 134344370
2-[(2R,3R,4R)-4-(6-aminopurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid (PubChem CID 134344370) has the molecular formula C13H16FN5O7 and a molecular weight of 373.30 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-4-(6-aminopurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid.
| Compound Name | 2-[(2R,3R,4R)-4-(6-aminopurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid |
|---|---|
| PubChem CID | 134344370 |
| Molecular Formula | C13H16FN5O7 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-[(2R,3R,4R)-4-(6-aminopurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid |
| SMILES | CO[C@H](COC(C(=O)O)C(=O)O)[C@@H](O)[C@@H](F)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H16FN5O7/c1-25-5(2-26-8(12(21)22)13(23)24)7(20)9(14)19-4-18-6-10(15)16-3-17-11(6)19/h3-5,7-9,20H,2H2,1H3,(H,21,22)(H,23,24)(H2,15,16,17)/t5-,7-,9+/m1/s1 |
| InChIKey | UADIQUFLDWIVNN-FKBGGTMYSA-N |
| XLogP | -1.19 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|