C18H12F5N3O2S — CID 134344498
6-fluoro-N-[6-(5-fluoro-2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide (PubChem CID 134344498) has the molecular formula C18H12F5N3O2S and a molecular weight of 429.37 g/mol. Its IUPAC name is 6-fluoro-N-[6-(5-fluoro-2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide.
| Compound Name | 6-fluoro-N-[6-(5-fluoro-2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 134344498 |
| Molecular Formula | C18H12F5N3O2S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 6-fluoro-N-[6-(5-fluoro-2-methylphenyl)-5-(trifluoromethyl)-2-pyridinyl]pyridine-2-sulfonamide |
| SMILES | Cc1ccc(F)cc1-c1nc(NS(=O)(=O)c2cccc(F)n2)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H12F5N3O2S/c1-10-5-6-11(19)9-12(10)17-13(18(21,22)23)7-8-15(25-17)26-29(27,28)16-4-2-3-14(20)24-16/h2-9H,1H3,(H,25,26) |
| InChIKey | RSZJUGXGYGDCCH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|