C19H31NO3 — CID 134344510
tert-butyl (1S,5R,6R,7S)-7-tert-butyl-3-oxo-5-prop-2-enyl-2-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 134344510) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is tert-butyl (1S,5R,6R,7S)-7-tert-butyl-3-oxo-5-prop-2-enyl-2-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | tert-butyl (1S,5R,6R,7S)-7-tert-butyl-3-oxo-5-prop-2-enyl-2-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 134344510 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | tert-butyl (1S,5R,6R,7S)-7-tert-butyl-3-oxo-5-prop-2-enyl-2-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=CC[C@@H]1CC(=O)N(C(=O)OC(C)(C)C)[C@H]2C[C@H](C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C19H31NO3/c1-8-9-12-10-15(21)20(17(22)23-19(5,6)7)14-11-13(16(12)14)18(2,3)4/h8,12-14,16H,1,9-11H2,2-7H3/t12-,13+,14+,16-/m1/s1 |
| InChIKey | QDYSAHSNGSOWFS-ORIJERBGSA-N |
| XLogP | 4.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|