About [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate
[[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate (PubChem CID 134345000) has the molecular formula C13H26N4O4
and a molecular weight of 302.38 g/mol. Its IUPAC name is [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate.
Molecular Properties
| Compound Name | [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate |
| PubChem CID | 134345000 |
| Molecular Formula | C13H26N4O4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate |
| SMILES | CCCNCC(=O)ON/C(CNC(=O)OC(C)(C)C)=N\C |
| InChI | InChI=1S/C13H26N4O4/c1-6-7-15-9-11(18)21-17-10(14-5)8-16-12(19)20-13(2,3)4/h15H,6-9H2,1-5H3,(H,14,17)(H,16,19) |
| InChIKey | BNQDOFMRIPXAMA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate?
The IUPAC name of [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate (CID 134345000) is [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate.
What is the SMILES notation for [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate?
The canonical SMILES for [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate is CCCNCC(=O)ON/C(CNC(=O)OC(C)(C)C)=N\C.
What is the InChIKey of [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate?
The InChIKey is BNQDOFMRIPXAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O4/c1-6-7-15-9-11(18)21-17-10(14-5)8-16-12(19)20-13(2,3)4/h15H,6-9H2,1-5H3,(H,14,17)(H,16,19).
What are the key properties of [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate?
[[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate has a molecular weight of 302.38 g/mol, XLogP of 0.59, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[N-methyl-C-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbonimidoyl]amino] 2-(propylamino)acetate is sourced from PubChem (CID 134345000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).