C35H41N7O3 — CID 134345074
N-(cyclopropylmethyl)-N'-[2-[2-[2-[(cyclopropylmethylamino)methoxy]ethoxy]phenyl]quinazolin-4-yl]-N'-(1H-indazol-5-yl)-1-methoxyethane-1,2-diamine (PubChem CID 134345074) has the molecular formula C35H41N7O3 and a molecular weight of 607.76 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-[2-[2-[2-[(cyclopropylmethylamino)methoxy]ethoxy]phenyl]quinazolin-4-yl]-N'-(1H-indazol-5-yl)-1-methoxyethane-1,2-diamine.
| Compound Name | N-(cyclopropylmethyl)-N'-[2-[2-[2-[(cyclopropylmethylamino)methoxy]ethoxy]phenyl]quinazolin-4-yl]-N'-(1H-indazol-5-yl)-1-methoxyethane-1,2-diamine |
|---|---|
| PubChem CID | 134345074 |
| Molecular Formula | C35H41N7O3 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-[2-[2-[2-[(cyclopropylmethylamino)methoxy]ethoxy]phenyl]quinazolin-4-yl]-N'-(1H-indazol-5-yl)-1-methoxyethane-1,2-diamine |
| SMILES | COC(CN(c1ccc2[nH]ncc2c1)c1nc(-c2ccccc2OCCOCNCC2CC2)nc2ccccc12)NCC1CC1 |
| InChI | InChI=1S/C35H41N7O3/c1-43-33(37-20-25-12-13-25)22-42(27-14-15-30-26(18-27)21-38-41-30)35-28-6-2-4-8-31(28)39-34(40-35)29-7-3-5-9-32(29)45-17-16-44-23-36-19-24-10-11-24/h2-9,14-15,18,21,24-25,33,36-37H,10-13,16-17,19-20,22-23H2,1H3,(H,38,41) |
| InChIKey | ZCXLDXJWLVWFJX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|