C30H27F4N5O5S2 — CID 134345100
(2S)-N-(1,3-benzothiazol-5-yl)-N-but-3-enyl-3-(3,5-difluorophenyl)-2-[[(2S)-1-(3,5-difluorophenyl)-3-oxopropan-2-yl]sulfamoylcarbamoylamino]propanamide (PubChem CID 134345100) has the molecular formula C30H27F4N5O5S2 and a molecular weight of 677.70 g/mol. Its IUPAC name is (2S)-N-(1,3-benzothiazol-5-yl)-N-but-3-enyl-3-(3,5-difluorophenyl)-2-[[(2S)-1-(3,5-difluorophenyl)-3-oxopropan-2-yl]sulfamoylcarbamoylamino]propanamide.
| Compound Name | (2S)-N-(1,3-benzothiazol-5-yl)-N-but-3-enyl-3-(3,5-difluorophenyl)-2-[[(2S)-1-(3,5-difluorophenyl)-3-oxopropan-2-yl]sulfamoylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 134345100 |
| Molecular Formula | C30H27F4N5O5S2 |
| Molecular Weight | 677.70 g/mol |
| Exact Mass | 677.14 |
| IUPAC Name | (2S)-N-(1,3-benzothiazol-5-yl)-N-but-3-enyl-3-(3,5-difluorophenyl)-2-[[(2S)-1-(3,5-difluorophenyl)-3-oxopropan-2-yl]sulfamoylcarbamoylamino]propanamide |
| SMILES | C=CCCN(C(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)NS(=O)(=O)N[C@H](C=O)Cc1cc(F)cc(F)c1)c1ccc2scnc2c1 |
| InChI | InChI=1S/C30H27F4N5O5S2/c1-2-3-6-39(25-4-5-28-26(15-25)35-17-45-28)29(41)27(12-19-9-22(33)14-23(34)10-19)36-30(42)38-46(43,44)37-24(16-40)11-18-7-20(31)13-21(32)8-18/h2,4-5,7-10,13-17,24,27,37H,1,3,6,11-12H2,(H2,36,38,42)/t24-,27-/m0/s1 |
| InChIKey | YFHJHIGSPAWDHT-IGKIAQTJSA-N |
| XLogP | 4.32 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.70 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|