C30H35N3O4 — CID 134345130
ethyl (4R)-4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-6-benzyl-1,2,3,4-tetrahydroquinoline-8-carboxylate (PubChem CID 134345130) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is ethyl (4R)-4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-6-benzyl-1,2,3,4-tetrahydroquinoline-8-carboxylate.
| Compound Name | ethyl (4R)-4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-6-benzyl-1,2,3,4-tetrahydroquinoline-8-carboxylate |
|---|---|
| PubChem CID | 134345130 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | ethyl (4R)-4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-6-benzyl-1,2,3,4-tetrahydroquinoline-8-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)cc2c1NCC[C@H]2NC(=O)[C@@H](N)Cc1c(C)cc(O)cc1C |
| InChI | InChI=1S/C30H35N3O4/c1-4-37-30(36)25-16-21(14-20-8-6-5-7-9-20)15-24-27(10-11-32-28(24)25)33-29(35)26(31)17-23-18(2)12-22(34)13-19(23)3/h5-9,12-13,15-16,26-27,32,34H,4,10-11,14,17,31H2,1-3H3,(H,33,35)/t26-,27+/m0/s1 |
| InChIKey | XVRWQIYTBSHIJJ-RRPNLBNLSA-N |
| XLogP | 4.32 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |