About (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine
(Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine (PubChem CID 134345178) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine.
Molecular Properties
| Compound Name | (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine |
| PubChem CID | 134345178 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine |
| SMILES | C/C=C\C=C(/N=C\C)N1CCNCC1 |
| InChI | InChI=1S/C11H19N3/c1-3-5-6-11(13-4-2)14-9-7-12-8-10-14/h3-6,12H,7-10H2,1-2H3/b5-3-,11-6+,13-4- |
| InChIKey | OAKHJTOHRSRLMS-DVYHLJTQSA-N |
| XLogP | 1.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine?
The IUPAC name of (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine (CID 134345178) is (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine.
What is the SMILES notation for (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine?
The canonical SMILES for (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine is C/C=C\C=C(/N=C\C)N1CCNCC1.
What is the InChIKey of (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine?
The InChIKey is OAKHJTOHRSRLMS-DVYHLJTQSA-N. The full InChI is InChI=1S/C11H19N3/c1-3-5-6-11(13-4-2)14-9-7-12-8-10-14/h3-6,12H,7-10H2,1-2H3/b5-3-,11-6+,13-4-.
What are the key properties of (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine?
(Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine has a molecular weight of 193.29 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[(1Z,3Z)-1-piperazin-1-ylpenta-1,3-dienyl]ethanimine is sourced from PubChem (CID 134345178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).