C11H19Cl3O — CID 13434521
1,1,1-trichloro-4,8-dimethylnon-7-en-2-ol (PubChem CID 13434521) has the molecular formula C11H19Cl3O and a molecular weight of 273.63 g/mol. Its IUPAC name is 1,1,1-trichloro-4,8-dimethylnon-7-en-2-ol.
| Compound Name | 1,1,1-trichloro-4,8-dimethylnon-7-en-2-ol |
|---|---|
| PubChem CID | 13434521 |
| Molecular Formula | C11H19Cl3O |
| Molecular Weight | 273.63 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1,1,1-trichloro-4,8-dimethylnon-7-en-2-ol |
| SMILES | CC(C)=CCCC(C)CC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H19Cl3O/c1-8(2)5-4-6-9(3)7-10(15)11(12,13)14/h5,9-10,15H,4,6-7H2,1-3H3 |
| InChIKey | JKRVJFDBVFWEJT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|