About phenazine;pyrido[3,2-b]quinoxaline
phenazine;pyrido[3,2-b]quinoxaline (PubChem CID 134346125) has the molecular formula C23H15N5
and a molecular weight of 361.41 g/mol. Its IUPAC name is phenazine;pyrido[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | phenazine;pyrido[3,2-b]quinoxaline |
| PubChem CID | 134346125 |
| Molecular Formula | C23H15N5 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | phenazine;pyrido[3,2-b]quinoxaline |
| SMILES | c1ccc2nc3ccccc3nc2c1.c1ccc2nc3ncccc3nc2c1 |
| InChI | InChI=1S/C12H8N2.C11H7N3/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-5-9-8(4-1)13-10-6-3-7-12-11(10)14-9/h1-8H;1-7H |
| InChIKey | HHCQVNKNKOXSOK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine;pyrido[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine;pyrido[3,2-b]quinoxaline?
The IUPAC name of phenazine;pyrido[3,2-b]quinoxaline (CID 134346125) is phenazine;pyrido[3,2-b]quinoxaline.
What is the SMILES notation for phenazine;pyrido[3,2-b]quinoxaline?
The canonical SMILES for phenazine;pyrido[3,2-b]quinoxaline is c1ccc2nc3ccccc3nc2c1.c1ccc2nc3ncccc3nc2c1.
What is the InChIKey of phenazine;pyrido[3,2-b]quinoxaline?
The InChIKey is HHCQVNKNKOXSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C11H7N3/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-5-9-8(4-1)13-10-6-3-7-12-11(10)14-9/h1-8H;1-7H.
What are the key properties of phenazine;pyrido[3,2-b]quinoxaline?
phenazine;pyrido[3,2-b]quinoxaline has a molecular weight of 361.41 g/mol, XLogP of 4.96, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine;pyrido[3,2-b]quinoxaline is sourced from PubChem (CID 134346125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).