C47H64N4O11 — CID 134346361
4-[4-(4-aminobutyl)naphthalen-1-yl]-2-[3-[bis[2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]propylamino]butanamide (PubChem CID 134346361) has the molecular formula C47H64N4O11 and a molecular weight of 861.05 g/mol. Its IUPAC name is 4-[4-(4-aminobutyl)naphthalen-1-yl]-2-[3-[bis[2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]propylamino]butanamide.
| Compound Name | 4-[4-(4-aminobutyl)naphthalen-1-yl]-2-[3-[bis[2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]propylamino]butanamide |
|---|---|
| PubChem CID | 134346361 |
| Molecular Formula | C47H64N4O11 |
| Molecular Weight | 861.05 g/mol |
| Exact Mass | 860.46 |
| IUPAC Name | 4-[4-(4-aminobutyl)naphthalen-1-yl]-2-[3-[bis[2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]propylamino]butanamide |
| SMILES | NCCCCc1ccc(CCC(NCCCN(CC(O)C(O)[C@@H]2OC(c3ccccc3)OC[C@H]2O)CC(O)C(O)[C@@H]2OC(c3ccccc3)OC[C@H]2O)C(N)=O)c2ccccc12 |
| InChI | InChI=1S/C47H64N4O11/c48-23-10-9-12-30-19-20-31(35-18-8-7-17-34(30)35)21-22-36(45(49)58)50-24-11-25-51(26-37(52)41(56)43-39(54)28-59-46(61-43)32-13-3-1-4-14-32)27-38(53)42(57)44-40(55)29-60-47(62-44)33-15-5-2-6-16-33/h1-8,13-20,36-44,46-47,50,52-57H,9-12,21-29,48H2,(H2,49,58)/t36?,37?,38?,39-,40-,41?,42?,43-,44-,46?,47?/m1/s1 |
| InChIKey | KGUOPXWSLHVHLR-JQTRZFOVSA-N |
| XLogP | 1.58 |
| TPSA | 242.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.05 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|