C23H21FN4O6 — CID 134346936
ethyl 11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate (PubChem CID 134346936) has the molecular formula C23H21FN4O6 and a molecular weight of 468.44 g/mol. Its IUPAC name is ethyl 11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate.
| Compound Name | ethyl 11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate |
|---|---|
| PubChem CID | 134346936 |
| Molecular Formula | C23H21FN4O6 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | ethyl 11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c(c(N4CCN(C)CC4)c(F)cc3c1=O)Oc1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C23H21FN4O6/c1-3-33-23(30)15-12-27-17-5-4-13(28(31)32)10-18(17)34-22-19(27)14(21(15)29)11-16(24)20(22)26-8-6-25(2)7-9-26/h4-5,10-12H,3,6-9H2,1-2H3 |
| InChIKey | SNWYZRZFYNBNNP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|