C25H23F2N3O4 — CID 134347548
1-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]-3-(4-phenoxyphenyl)urea (PubChem CID 134347548) has the molecular formula C25H23F2N3O4 and a molecular weight of 467.47 g/mol. Its IUPAC name is 1-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 134347548 |
| Molecular Formula | C25H23F2N3O4 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-[(3S,4S)-4-(2,6-difluoro-4-methoxyphenyl)-6-oxopiperidin-3-yl]-3-(4-phenoxyphenyl)urea |
| SMILES | COc1cc(F)c([C@@H]2CC(=O)NC[C@H]2NC(=O)Nc2ccc(Oc3ccccc3)cc2)c(F)c1 |
| InChI | InChI=1S/C25H23F2N3O4/c1-33-18-11-20(26)24(21(27)12-18)19-13-23(31)28-14-22(19)30-25(32)29-15-7-9-17(10-8-15)34-16-5-3-2-4-6-16/h2-12,19,22H,13-14H2,1H3,(H,28,31)(H2,29,30,32)/t19-,22-/m1/s1 |
| InChIKey | RIGKTJGDRNQHHY-DENIHFKCSA-N |
| XLogP | 4.56 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |