C20H21NO4 — CID 134347611
(3R,4S)-1-benzyl-4-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid (PubChem CID 134347611) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid.
| Compound Name | (3R,4S)-1-benzyl-4-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134347611 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3R,4S)-1-benzyl-4-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid |
| SMILES | COc1ccc([C@H]2CC(=O)N(Cc3ccccc3)C[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-25-16-9-7-15(8-10-16)17-11-19(22)21(13-18(17)20(23)24)12-14-5-3-2-4-6-14/h2-10,17-18H,11-13H2,1H3,(H,23,24)/t17-,18+/m1/s1 |
| InChIKey | HICMNIHEOORWOR-MSOLQXFVSA-N |
| XLogP | 2.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |