C10H12 — CID 13434773
(1'R,2'S,4'R,5'S)-spiro[cyclopropane-1,8'-tricyclo[3.2.1.02,4]oct-6-ene] (PubChem CID 13434773) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is (1'R,2'S,4'R,5'S)-spiro[cyclopropane-1,8'-tricyclo[3.2.1.02,4]oct-6-ene].
| Compound Name | (1'R,2'S,4'R,5'S)-spiro[cyclopropane-1,8'-tricyclo[3.2.1.02,4]oct-6-ene] |
|---|---|
| PubChem CID | 13434773 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (1'R,2'S,4'R,5'S)-spiro[cyclopropane-1,8'-tricyclo[3.2.1.02,4]oct-6-ene] |
| SMILES | C1=C[C@H]2[C@@H]3C[C@@H]3[C@@H]1C21CC1 |
| InChI | InChI=1S/C10H12/c1-2-9-7-5-6(7)8(1)10(9)3-4-10/h1-2,6-9H,3-5H2/t6-,7+,8+,9- |
| InChIKey | RFUFIAVZMUUTNM-OJOKCITNSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|