C16H18N2O2 — CID 134348163
6'-methylspiro[1,3-dioxolane-2,3'-4,4a,5,8-tetrahydro-2H-benzo[7]annulene]-9',9'-dicarbonitrile (PubChem CID 134348163) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 6'-methylspiro[1,3-dioxolane-2,3'-4,4a,5,8-tetrahydro-2H-benzo[7]annulene]-9',9'-dicarbonitrile.
| Compound Name | 6'-methylspiro[1,3-dioxolane-2,3'-4,4a,5,8-tetrahydro-2H-benzo[7]annulene]-9',9'-dicarbonitrile |
|---|---|
| PubChem CID | 134348163 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 6'-methylspiro[1,3-dioxolane-2,3'-4,4a,5,8-tetrahydro-2H-benzo[7]annulene]-9',9'-dicarbonitrile |
| SMILES | CC1=CCC(C#N)(C#N)C2=CCC3(CC2C1)OCCO3 |
| InChI | InChI=1S/C16H18N2O2/c1-12-2-4-15(10-17,11-18)14-3-5-16(9-13(14)8-12)19-6-7-20-16/h2-3,13H,4-9H2,1H3 |
| InChIKey | LYTBQRGJCUNRAJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|