C17H21NO4 — CID 134348167
4a-O-ethyl 9-O-methyl 9-cyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a,9-dicarboxylate (PubChem CID 134348167) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4a-O-ethyl 9-O-methyl 9-cyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a,9-dicarboxylate.
| Compound Name | 4a-O-ethyl 9-O-methyl 9-cyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a,9-dicarboxylate |
|---|---|
| PubChem CID | 134348167 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4a-O-ethyl 9-O-methyl 9-cyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a,9-dicarboxylate |
| SMILES | CCOC(=O)C12CC=CCC(C#N)(C(=O)OC)C1=CCCC2 |
| InChI | InChI=1S/C17H21NO4/c1-3-22-15(20)16-9-5-4-8-13(16)17(12-18,14(19)21-2)11-7-6-10-16/h6-8H,3-5,9-11H2,1-2H3 |
| InChIKey | QKSRCABMQXQFFC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|