About [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate
[4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate (PubChem CID 134348194) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate.
Molecular Properties
| Compound Name | [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate |
| PubChem CID | 134348194 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate |
| SMILES | C=C(COC(C)=O)CC(C#N)(C#N)C1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C17H20N2O4/c1-13(10-21-14(2)20)9-16(11-18,12-19)15-3-5-17(6-4-15)22-7-8-23-17/h3H,1,4-10H2,2H3 |
| InChIKey | FVCGFJPMMBVMBE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate?
The IUPAC name of [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate (CID 134348194) is [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate.
What is the SMILES notation for [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate?
The canonical SMILES for [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate is C=C(COC(C)=O)CC(C#N)(C#N)C1=CCC2(CC1)OCCO2.
What is the InChIKey of [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate?
The InChIKey is FVCGFJPMMBVMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-13(10-21-14(2)20)9-16(11-18,12-19)15-3-5-17(6-4-15)22-7-8-23-17/h3H,1,4-10H2,2H3.
What are the key properties of [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate?
[4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate has a molecular weight of 316.36 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dicyano-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-2-methylidenebutyl] acetate is sourced from PubChem (CID 134348194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).