C13H15NO3 — CID 134348471
ethyl 1-methyl-4-oxo-2,3-dihydroquinoline-8-carboxylate (PubChem CID 134348471) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is ethyl 1-methyl-4-oxo-2,3-dihydroquinoline-8-carboxylate.
| Compound Name | ethyl 1-methyl-4-oxo-2,3-dihydroquinoline-8-carboxylate |
|---|---|
| PubChem CID | 134348471 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | ethyl 1-methyl-4-oxo-2,3-dihydroquinoline-8-carboxylate |
| SMILES | CCOC(=O)c1cccc2c1N(C)CCC2=O |
| InChI | InChI=1S/C13H15NO3/c1-3-17-13(16)10-6-4-5-9-11(15)7-8-14(2)12(9)10/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | ABUVWVMAQJNENV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |