About [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate
[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate (PubChem CID 134348907) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate.
Molecular Properties
| Compound Name | [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate |
| PubChem CID | 134348907 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate |
| SMILES | NNC(=O)OC1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H17N3O4/c13-14-12(18)19-9-3-1-8(2-4-9)7-15-10(16)5-6-11(15)17/h5-6,8-9H,1-4,7,13H2,(H,14,18) |
| InChIKey | OYMDSTPVLCHKJU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate?
The IUPAC name of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate (CID 134348907) is [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate.
What is the SMILES notation for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate?
The canonical SMILES for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate is NNC(=O)OC1CCC(CN2C(=O)C=CC2=O)CC1.
What is the InChIKey of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate?
The InChIKey is OYMDSTPVLCHKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c13-14-12(18)19-9-3-1-8(2-4-9)7-15-10(16)5-6-11(15)17/h5-6,8-9H,1-4,7,13H2,(H,14,18).
What are the key properties of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate?
[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate has a molecular weight of 267.28 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl] N-aminocarbamate is sourced from PubChem (CID 134348907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).