C11H19NO — CID 134349628
(E)-N-(cyclopropylmethyl)-5-methylhex-2-enamide (PubChem CID 134349628) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (E)-N-(cyclopropylmethyl)-5-methylhex-2-enamide.
| Compound Name | (E)-N-(cyclopropylmethyl)-5-methylhex-2-enamide |
|---|---|
| PubChem CID | 134349628 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (E)-N-(cyclopropylmethyl)-5-methylhex-2-enamide |
| SMILES | CC(C)C/C=C/C(=O)NCC1CC1 |
| InChI | InChI=1S/C11H19NO/c1-9(2)4-3-5-11(13)12-8-10-6-7-10/h3,5,9-10H,4,6-8H2,1-2H3,(H,12,13)/b5-3+ |
| InChIKey | QKQAINPCEFDPMG-HWKANZROSA-N |
| XLogP | 2.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|