C19H24N2O3 — CID 134349725
2-[(2R,3S)-1-benzyl-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-N-cyclopropyl-2-oxoacetamide (PubChem CID 134349725) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[(2R,3S)-1-benzyl-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-N-cyclopropyl-2-oxoacetamide.
| Compound Name | 2-[(2R,3S)-1-benzyl-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-N-cyclopropyl-2-oxoacetamide |
|---|---|
| PubChem CID | 134349725 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[(2R,3S)-1-benzyl-5-oxo-3-propan-2-ylpyrrolidin-2-yl]-N-cyclopropyl-2-oxoacetamide |
| SMILES | CC(C)[C@@H]1CC(=O)N(Cc2ccccc2)[C@H]1C(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C19H24N2O3/c1-12(2)15-10-16(22)21(11-13-6-4-3-5-7-13)17(15)18(23)19(24)20-14-8-9-14/h3-7,12,14-15,17H,8-11H2,1-2H3,(H,20,24)/t15-,17+/m0/s1 |
| InChIKey | UJXFRPMHJNQEFT-DOTOQJQBSA-N |
| XLogP | 1.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|