C34H41N5O4 — CID 134349780
2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]-1-[2-(cyclohexen-1-yl)ethyl]benzimidazole-5-carboxylic acid (PubChem CID 134349780) has the molecular formula C34H41N5O4 and a molecular weight of 583.73 g/mol. Its IUPAC name is 2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]-1-[2-(cyclohexen-1-yl)ethyl]benzimidazole-5-carboxylic acid.
| Compound Name | 2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]-1-[2-(cyclohexen-1-yl)ethyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 134349780 |
| Molecular Formula | C34H41N5O4 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | 2-[bis[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]amino]-1-[2-(cyclohexen-1-yl)ethyl]benzimidazole-5-carboxylic acid |
| SMILES | COc1c(C)cnc(CN(Cc2ncc(C)c(OC)c2C)c2nc3cc(C(=O)O)ccc3n2CCC2=CCCCC2)c1C |
| InChI | InChI=1S/C34H41N5O4/c1-21-17-35-28(23(3)31(21)42-5)19-38(20-29-24(4)32(43-6)22(2)18-36-29)34-37-27-16-26(33(40)41)12-13-30(27)39(34)15-14-25-10-8-7-9-11-25/h10,12-13,16-18H,7-9,11,14-15,19-20H2,1-6H3,(H,40,41) |
| InChIKey | XZHQBAJZRQWYAP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|