About [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate
[4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate (PubChem CID 134349841) has the molecular formula C12H19N3O2S
and a molecular weight of 269.37 g/mol. Its IUPAC name is [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate.
Molecular Properties
| Compound Name | [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate |
| PubChem CID | 134349841 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate |
| SMILES | NCc1cnc(CC2CCC(OC(N)=O)CC2)s1 |
| InChI | InChI=1S/C12H19N3O2S/c13-6-10-7-15-11(18-10)5-8-1-3-9(4-2-8)17-12(14)16/h7-9H,1-6,13H2,(H2,14,16) |
| InChIKey | YEDQNKARHQSRCV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate?
The IUPAC name of [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate (CID 134349841) is [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate.
What is the SMILES notation for [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate?
The canonical SMILES for [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate is NCc1cnc(CC2CCC(OC(N)=O)CC2)s1.
What is the InChIKey of [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate?
The InChIKey is YEDQNKARHQSRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2S/c13-6-10-7-15-11(18-10)5-8-1-3-9(4-2-8)17-12(14)16/h7-9H,1-6,13H2,(H2,14,16).
What are the key properties of [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate?
[4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate has a molecular weight of 269.37 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[5-(aminomethyl)-1,3-thiazol-2-yl]methyl]cyclohexyl] carbamate is sourced from PubChem (CID 134349841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).