C35H52N2O3 — CID 134350566
1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-[4-(1-tert-butyl-5,5-dimethyl-6-propanoyl-3,4-dihydro-2H-azepin-3-yl)phenyl]propane-1,3-dione (PubChem CID 134350566) has the molecular formula C35H52N2O3 and a molecular weight of 548.81 g/mol. Its IUPAC name is 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-[4-(1-tert-butyl-5,5-dimethyl-6-propanoyl-3,4-dihydro-2H-azepin-3-yl)phenyl]propane-1,3-dione.
| Compound Name | 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-[4-(1-tert-butyl-5,5-dimethyl-6-propanoyl-3,4-dihydro-2H-azepin-3-yl)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 134350566 |
| Molecular Formula | C35H52N2O3 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.40 |
| IUPAC Name | 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-[4-(1-tert-butyl-5,5-dimethyl-6-propanoyl-3,4-dihydro-2H-azepin-3-yl)phenyl]propane-1,3-dione |
| SMILES | CCC(=O)C1=CN(C(C)(C)C)CC(c2ccc(C(=O)CC(=O)C3=CN(C(C)(C)C)CCC3(C)C)cc2)CC1(C)C |
| InChI | InChI=1S/C35H52N2O3/c1-12-29(38)27-23-37(33(5,6)7)21-26(20-35(27,10)11)24-13-15-25(16-14-24)30(39)19-31(40)28-22-36(32(2,3)4)18-17-34(28,8)9/h13-16,22-23,26H,12,17-21H2,1-11H3 |
| InChIKey | AQELLGDJAQJKGK-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|