C16H32O3S2 — CID 134350721
(1S,2S)-2-[bis(ethylsulfanyl)methyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-1-ol (PubChem CID 134350721) has the molecular formula C16H32O3S2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (1S,2S)-2-[bis(ethylsulfanyl)methyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-1-ol.
| Compound Name | (1S,2S)-2-[bis(ethylsulfanyl)methyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 134350721 |
| Molecular Formula | C16H32O3S2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (1S,2S)-2-[bis(ethylsulfanyl)methyl]-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-1-ol |
| SMILES | CCSC(SCC)[C@@H](CC(C)C)[C@H](O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H32O3S2/c1-7-20-15(21-8-2)12(9-11(3)4)14(17)13-10-18-16(5,6)19-13/h11-15,17H,7-10H2,1-6H3/t12-,13-,14-/m0/s1 |
| InChIKey | NNKBRBMHCOEREO-IHRRRGAJSA-N |
| XLogP | 3.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|