C24H38F6N2O — CID 134350848
5,5,5-trifluoro-4-N-[(4-methoxyphenyl)methyl]-2,2,4-trimethyl-1-N-(1,1,1-trifluoro-2,4,4-trimethylpentan-2-yl)pentane-1,4-diamine (PubChem CID 134350848) has the molecular formula C24H38F6N2O and a molecular weight of 484.57 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-N-[(4-methoxyphenyl)methyl]-2,2,4-trimethyl-1-N-(1,1,1-trifluoro-2,4,4-trimethylpentan-2-yl)pentane-1,4-diamine.
| Compound Name | 5,5,5-trifluoro-4-N-[(4-methoxyphenyl)methyl]-2,2,4-trimethyl-1-N-(1,1,1-trifluoro-2,4,4-trimethylpentan-2-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 134350848 |
| Molecular Formula | C24H38F6N2O |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 5,5,5-trifluoro-4-N-[(4-methoxyphenyl)methyl]-2,2,4-trimethyl-1-N-(1,1,1-trifluoro-2,4,4-trimethylpentan-2-yl)pentane-1,4-diamine |
| SMILES | COc1ccc(CNC(C)(CC(C)(C)CNC(C)(CC(C)(C)C)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H38F6N2O/c1-19(2,3)14-21(6,23(25,26)27)32-16-20(4,5)15-22(7,24(28,29)30)31-13-17-9-11-18(33-8)12-10-17/h9-12,31-32H,13-16H2,1-8H3 |
| InChIKey | DRFZQBAEPHOESX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |