About ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate
ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate (PubChem CID 134351001) has the molecular formula C18H33N3O3
and a molecular weight of 339.48 g/mol. Its IUPAC name is ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate |
| PubChem CID | 134351001 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(CC)CCC(N2CC3(CCNCC3)NC2O)CC1 |
| InChI | InChI=1S/C18H33N3O3/c1-3-17(15(22)24-4-2)7-5-14(6-8-17)21-13-18(20-16(21)23)9-11-19-12-10-18/h14,16,19-20,23H,3-13H2,1-2H3 |
| InChIKey | RKZCAXZKLQRCES-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate?
The IUPAC name of ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate (CID 134351001) is ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate is CCOC(=O)C1(CC)CCC(N2CC3(CCNCC3)NC2O)CC1.
What is the InChIKey of ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate?
The InChIKey is RKZCAXZKLQRCES-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3O3/c1-3-17(15(22)24-4-2)7-5-14(6-8-17)21-13-18(20-16(21)23)9-11-19-12-10-18/h14,16,19-20,23H,3-13H2,1-2H3.
What are the key properties of ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate?
ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate has a molecular weight of 339.48 g/mol, XLogP of 1.19, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethyl-4-(2-hydroxy-1,3,8-triazaspiro[4.5]decan-3-yl)cyclohexane-1-carboxylate is sourced from PubChem (CID 134351001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).