C13H26N2O — CID 134351464
(3aS,6aR)-5-(3-methoxypropyl)-2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole (PubChem CID 134351464) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (3aS,6aR)-5-(3-methoxypropyl)-2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-(3-methoxypropyl)-2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 134351464 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (3aS,6aR)-5-(3-methoxypropyl)-2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole |
| SMILES | COCCCN1C[C@]2(C)CN(C)C[C@]2(C)C1 |
| InChI | InChI=1S/C13H26N2O/c1-12-8-14(3)9-13(12,2)11-15(10-12)6-5-7-16-4/h5-11H2,1-4H3/t12-,13+ |
| InChIKey | CMHPLSJGWXMMQU-BETUJISGSA-N |
| XLogP | 1.30 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|