C22H23N — CID 134351479
6-tert-butyl-9-phenyl-3,4-dihydrocarbazole (PubChem CID 134351479) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is 6-tert-butyl-9-phenyl-3,4-dihydrocarbazole.
| Compound Name | 6-tert-butyl-9-phenyl-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 134351479 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 6-tert-butyl-9-phenyl-3,4-dihydrocarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1c(n2-c2ccccc2)C=CCC1 |
| InChI | InChI=1S/C22H23N/c1-22(2,3)16-13-14-21-19(15-16)18-11-7-8-12-20(18)23(21)17-9-5-4-6-10-17/h4-6,8-10,12-15H,7,11H2,1-3H3 |
| InChIKey | VZNAZDKCBSCRNA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |